Introduction:Basic information about CAS 302963-94-6|N-Boc-2-amino-4-methylthiazole-5-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Boc-2-amino-4-methylthiazole-5-carboxylic acid |
|---|
| CAS Number | 302963-94-6 | Molecular Weight | 258.29400 |
|---|
| Density | 1.359g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H14N2O4S | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazole-5-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.359g/cm3 |
|---|
| Molecular Formula | C10H14N2O4S |
|---|
| Molecular Weight | 258.29400 |
|---|
| Exact Mass | 258.06700 |
|---|
| PSA | 116.76000 |
|---|
| LogP | 2.56970 |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | FHNRXEYKJBDNKP-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(NC(=O)OC(C)(C)C)sc1C(=O)O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 43 |
|---|
| Safety Phrases | 36/37 |
|---|
| HS Code | 2934100090 |
|---|
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| MFCD01631191 |
| 2-tert-butoxycarbonyloxyamino-4-methyl-thiazole-5-carboxylic acid |
| N-Boc-2-amino-4-methylthiazole-5-carboxylic acid |
| N-Boc-amino-4-methylthiazole-5-carboxylic acid |
| 2-((tert-Butoxycarbonyl)amino)-4-methylthiazole-5-carboxylic acid |