Introduction:Basic information about CAS 198220-45-0|2,4-Dimethyl-6-(6-methylheptyl)phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-Dimethyl-6-(6-methylheptyl)phenol |
|---|
| CAS Number | 198220-45-0 | Molecular Weight | 234.377 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 328.7±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H26O | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 148.1±8.9 °C |
|---|
Names
| Name | 2,4-dimethyl-6-(6-methylheptyl)phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 328.7±11.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H26O |
|---|
| Molecular Weight | 234.377 |
|---|
| Flash Point | 148.1±8.9 °C |
|---|
| Exact Mass | 234.198364 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 6.40 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.506 |
|---|
| InChIKey | JTOOCBHWULMDHW-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(O)c(CCCCCC(C)C)c1 |
|---|
Synonyms
| 2,4-dimethyl-6-isooctylphenol |
| Phenol, 2,4-dimethyl-6-(6-methylheptyl)- |
| 2,4-Dimethyl-6-(6-methylheptyl)phenol |
| 2,4-diacetyl-5-methyl-2,4-dihydro-3h-pyrazol-3-one |