Introduction:Basic information about CAS 40947-69-1|4-[(4-Amino-5-methoxy-2-methylphenyl)azo]benzenesulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(4-Amino-5-methoxy-2-methylphenyl)azo]benzenesulfonic acid |
|---|
| CAS Number | 40947-69-1 | Molecular Weight | 321.352 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H15N3O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-[(4-Amino-5-methoxy-2-methylphenyl)azo]benzenesulfonic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Molecular Formula | C14H15N3O4S |
|---|
| Molecular Weight | 321.352 |
|---|
| Exact Mass | 321.078339 |
|---|
| PSA | 122.72000 |
|---|
| LogP | 2.94 |
|---|
| Index of Refraction | 1.630 |
|---|
| InChIKey | RFHAPRIQUZZKDJ-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(N=Nc2ccc(S(=O)(=O)O)cc2)c(C)cc1N |
|---|
Safety Information
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4-(4-amino-5-methoxy-2-methyl-phenylazo)-benzenesulfonic acid |
| 2-Methoxy-5-methyl-4-[(4-sulfophenyl)azo]benzenamine |
| Benzenesulfonic acid, 4-((4-amino-5-methoxy-2-methylphenyl)azo)-, |
| 4-(4-Amino-5-methoxy-2-methyl-phenylazo)-benzolsulfonsaeure |
| Benzenesulfonic acid, 4-[(E)-2-(4-amino-5-methoxy-2-methylphenyl)diazenyl]- |
| sulfanilic acid cresidine |
| 4-[(4-Amino-5-methox |
| 2-methoxy-5-methyl-4-(4-sulfophenylazo)aniline |
| 4-[(E)-(4-Amino-5-methoxy-2-methylphenyl)diazenyl]benzenesulfonic acid |
| p-[(4-amino-5-methoxy-o-tolyl)azo]benzenesulphonic acid |
| p-[(4-amino-5-methoxy-o-tolyl)azo]benzenesulfonic acid |