Introduction：Basic information about CAS 126657-30-5|3,5-Dimethyl-3',5'-ditert-butyldiphenoquinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-Dimethyl-3',5'-ditert-butyldiphenoquinone |
|---|
| CAS Number | 126657-30-5 | Molecular Weight | 324.45700 |
|---|
| Density | 1.058 | Boiling Point | 433.2ºC at 760mmHg |
|---|
| Molecular Formula | C22H28O2 | Melting Point | 180-181ºC |
|---|
| MSDS | / | Flash Point | 161.7ºC |
|---|
Names
| Name | 4-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2,6-dimethylcyclohexa-2,5-dien-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.058 |
|---|
| Boiling Point | 433.2ºC at 760mmHg |
|---|
| Melting Point | 180-181ºC |
|---|
| Molecular Formula | C22H28O2 |
|---|
| Molecular Weight | 324.45700 |
|---|
| Flash Point | 161.7ºC |
|---|
| Exact Mass | 324.20900 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 5.28600 |
|---|
| Vapour Pressure | 1.05E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | QJQMLCUZRRVCPJ-UHFFFAOYSA-N |
|---|
| SMILES | CC1=CC(=C2C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)C=C(C)C1=O |
|---|
Synonyms
| 3,5-dimethyl-3',5'-ditertiarybutyldiphenoquinone |
| 2,6-BIS(1,1-DIMETHYLETHYL)-4-(3,5-DIMETHYL-4-OXO-2,5-CYCLOHEXADIEN-1-YLIDENE)-2,5-CYCLOHEXADIEN-1-ONE |
| 3,5-dimethyl-3',5'-di-t-butyldiphenoquinone |
| 3,5-Dimethyl-3',5'-di-tert-butyl-4,4'-diphenoquinone |
| 3,5-dimethyl-3',5'-di-t-butyl-4,4'-diphenoquinone |
| 4-(3,5-ditert-butyl-4-oxo-1-cyclohexa-2,5-dienylidene)-2,6-dimethyl-1-cyclohexa-2,5-dienone |
| 4-(3,5-ditert-butyl-4-oxidanylidene-cyclohexa-2,5-dien-1-ylidene)-2,6-dimethyl-cyclohexa-2,5-dien-1-one |
| 3,5-Dimethyl-3',5'-ditert-butyldiphenoquinone |
