Introduction:Basic information about CAS 51787-75-8|4,4'-Dinitro-2-biphenylamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Dinitro-2-biphenylamine |
|---|
| CAS Number | 51787-75-8 | Molecular Weight | 259.21800 |
|---|
| Density | 1.434g/cm3 | Boiling Point | 472ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9N3O4 | Melting Point | 208-210ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 239.3ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 5-nitro-2-(4-nitrophenyl)aniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.434g/cm3 |
|---|
| Boiling Point | 472ºC at 760 mmHg |
|---|
| Melting Point | 208-210ºC(lit.) |
|---|
| Molecular Formula | C12H9N3O4 |
|---|
| Molecular Weight | 259.21800 |
|---|
| Flash Point | 239.3ºC |
|---|
| Exact Mass | 259.05900 |
|---|
| PSA | 117.66000 |
|---|
| LogP | 4.37980 |
|---|
| Index of Refraction | 1.678 |
|---|
| InChIKey | FRZPYFUNNLIMEC-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc([N+](=O)[O-])ccc1-c1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2921499090 |
|---|
Customs
| HS Code | 2921499090 |
|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 5-nitro-2-(4-nitrophenyl)phenylamine |
| 1-amino-3,8-dinitrobiphenyl |
| 4,4'-Dinitro-biphenyl-2-ylamin |
| 4,4'-Dinitro-2-biphenylamine |
| 2-amino-4,4'-dinitrobiphenyl |
| 4,4'-dinitrobiphenyl-2-amine |
| 4.4'-Dinitro-2-amino-biphenyl |
| amino-2 dinitro-4,4' biphenyle |
| 4,4'-Dinitrobiphenyl-2-ylamine |
| (1,1'-Biphenyl)-2-amine,4,4'-dinitro |
| MFCD00075056 |
| 4,4`-Dinitro-2-biphenylamine |
| 4,4'-Dinitro-(1,1'-biphenyl)-2-amine |
| EINECS 257-417-8 |