Introduction:Basic information about CAS 2109-73-1|Acetamide, N-(4-(1,1-dimethylethoxy)phenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetamide, N-(4-(1,1-dimethylethoxy)phenyl)- |
|---|
| CAS Number | 2109-73-1 | Molecular Weight | 207.26900 |
|---|
| Density | 1.057g/cm3 | Boiling Point | 363.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H17NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 173.6ºC |
|---|
Names
| Name | N-[4-[(2-methylpropan-2-yl)oxy]phenyl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.057g/cm3 |
|---|
| Boiling Point | 363.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H17NO2 |
|---|
| Molecular Weight | 207.26900 |
|---|
| Flash Point | 173.6ºC |
|---|
| Exact Mass | 207.12600 |
|---|
| PSA | 38.33000 |
|---|
| LogP | 2.89530 |
|---|
| Vapour Pressure | 1.81E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.535 |
|---|
| InChIKey | QTNZYVAMNRDUAD-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc(OC(C)(C)C)cc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Acetanilide,4'-tert-butoxy |
| Butacetin (USAN) |
| Tromal |
| BUTACETIN |
| p-tert-Butotyacetanilid |
| 4'-tert-Butoxyacetanilide |
| BW 63-90 |
| Essigsaeure-(4-tert-butoxy-anilid) |
| acetic acid-(4-tert-butoxy-anilide) |
| N-(4-tert-butoxyphenyl)acetamide |