Introduction：Basic information about CAS 95349-35-2|[Benzyl(methyl)phenylsilyl]acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [Benzyl(methyl)phenylsilyl]acetic acid |
|---|
| CAS Number | 95349-35-2 | Molecular Weight | 270.398 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 420.2±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H18O2Si | Melting Point | 70ºC |
|---|
| MSDS | / | Flash Point | 207.9±26.8 °C |
|---|
Names
| Name | (-)-Benzylmethylphenylsilylacetic Acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 420.2±38.0 °C at 760 mmHg |
|---|
| Melting Point | 70ºC |
|---|
| Molecular Formula | C16H18O2Si |
|---|
| Molecular Weight | 270.398 |
|---|
| Flash Point | 207.9±26.8 °C |
|---|
| Exact Mass | 270.107605 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.79 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | JIPQZCPYHVQEIZ-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](CC(=O)O)(Cc1ccccc1)c1ccccc1 |
|---|
Synonyms
| Acetic acid, 2-[methylphenyl(phenylmethyl)silyl]- |
| [Benzyl(methyl)phenylsilyl]acetic acid |
| (-)-benzylmethylphenylsilylacetic acid |
