Introduction:Basic information about CAS 154150-18-2|tert-Butyl (2-methoxyphenyl)carbamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl (2-methoxyphenyl)carbamate |
|---|
| CAS Number | 154150-18-2 | Molecular Weight | 223.268 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 276.0±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H17NO3 | Melting Point | 33.5-35.0 ℃ |
|---|
| MSDS | ChineseUSA | Flash Point | 120.7±22.6 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | tert-butyl N-(2-methoxyphenyl)carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 276.0±23.0 °C at 760 mmHg |
|---|
| Melting Point | 33.5-35.0 ℃ |
|---|
| Molecular Formula | C12H17NO3 |
|---|
| Molecular Weight | 223.268 |
|---|
| Flash Point | 120.7±22.6 °C |
|---|
| Exact Mass | 223.120850 |
|---|
| PSA | 47.56000 |
|---|
| LogP | 3.01 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.533 |
|---|
| InChIKey | DHSWMVURURVRDB-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccccc1NC(=O)OC(C)(C)C |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 22-36/37/38 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| tert-Butyl (2-methoxyphenyl)carbamate |
| Carbamic acid, N-(2-methoxyphenyl)-, 1,1-dimethylethyl ester |
| N-(2-methoxyphenyl)-1,1-dimethylethyl ester carbamic acid |
| N-Boc-2-methoxyaniline |
| N-BOC-O-ANISIDINE |
| N-(tert-butoxycarbonyl)-2-methoxyaniline |
| (2-Mehtoxyphenyl)-carbamic acid, 1,1-dimethyl ethyl ester |
| 2-Methyl-2-propanyl (2-methoxyphenyl)carbamate |
| 2-t-butoxycarbonylamino-1-methoxybenzene |
| N-((o-methoxy)phenyl)-O-(tert-butyl)carbamate |
| N-(2-Methoxyphenyl)-Carbamic Acid 1,1-Dimethylethyl Ester |
| BOC-O-ANISIDINE |
| Tert-butyl 2-methoxyphenylcarbamate |
| t-butyl (o-methoxyphenyl)carbamate |
| (2-Mehtoxyphenyl)-carbamic acid,1,1-dimethyl ethyl ester |
| AmbkkkkK259 |