Introduction：Basic information about CAS 15485-63-9|Ethanone,1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethanone,1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)- |
|---|
| CAS Number | 15485-63-9 | Molecular Weight | 273.24100 |
|---|
| Density | 1.435g/cm3 | Boiling Point | 523.6ºC at 760mmHg |
|---|
| Molecular Formula | C14H11NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.3ºC |
|---|
Names
| Name | 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.435g/cm3 |
|---|
| Boiling Point | 523.6ºC at 760mmHg |
|---|
| Molecular Formula | C14H11NO5 |
|---|
| Molecular Weight | 273.24100 |
|---|
| Flash Point | 222.3ºC |
|---|
| Exact Mass | 273.06400 |
|---|
| PSA | 103.35000 |
|---|
| LogP | 2.95460 |
|---|
| Vapour Pressure | 1.4E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.669 |
|---|
| InChIKey | OGFAWKRXZLGJSK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)c1ccc(O)cc1O |
|---|
Synonyms
| 1-(2,4-Dihydroxy-phenyl)-2-(4-nitro-phenyl)-ethanone |
| 2,4-dihydroxy-4'-nitro-deoxybenzoin |
| 2,4-Dihydroxy-4'-nitro-desoxybenzoin |
| 1,4-Dihydroxyphenyl 4-nitrobenzyl ketone |
| ethanone,1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl) |
| 4'-Nitro-2,4-dihydroxy-desoxybenzoin |
