Introduction：Basic information about CAS 879624-53-0|ASISCHEM C48593, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ASISCHEM C48593 |
|---|
| CAS Number | 879624-53-0 | Molecular Weight | 235.67300 |
|---|
| Density | 1.422g/cm3 | Boiling Point | 450.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10ClN5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 226.4ºC |
|---|
Names
| Name | 2-N-(3-chloro-2-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|
Chemical & Physical Properties
| Density | 1.422g/cm3 |
|---|
| Boiling Point | 450.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10ClN5 |
|---|
| Molecular Weight | 235.67300 |
|---|
| Flash Point | 226.4ºC |
|---|
| Exact Mass | 235.06200 |
|---|
| PSA | 76.72000 |
|---|
| LogP | 2.81340 |
|---|
| Index of Refraction | 1.697 |
|---|
| InChIKey | XYWGUTRJUZSEQY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(Cl)cccc1Nc1ncnc(N)n1 |
|---|
Safety Information
Customs
| HS Code | 2933699090 |
|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
|---|
