Introduction：Basic information about CAS 38791-62-7|4-Phenoxyphthalonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Phenoxyphthalonitrile |
|---|
| CAS Number | 38791-62-7 | Molecular Weight | 220.226 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 399.8±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H8N2O | Melting Point | 98-100ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 166.1±19.4 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-Phenoxyphthalonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 399.8±37.0 °C at 760 mmHg |
|---|
| Melting Point | 98-100ºC(lit.) |
|---|
| Molecular Formula | C14H8N2O |
|---|
| Molecular Weight | 220.226 |
|---|
| Flash Point | 166.1±19.4 °C |
|---|
| Exact Mass | 220.063660 |
|---|
| PSA | 56.81000 |
|---|
| LogP | 3.78 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.626 |
|---|
| InChIKey | CRZSSXUMRNESCC-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1ccc(Oc2ccccc2)cc1C#N |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
|---|
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 4-PHENOXY-PHTHALONITRILE |
| 4-Phenoxyphthalonitrile |
| 4-phenoxybenzene-1,2-dicarbonitrile |
| 1,2-Benzenedicarbonitrile, 4-phenoxy- |
| MFCD00187787 |
