Introduction:Basic information about CAS 57496-24-9|2-amino-2-cyclohexyl-2-phenylacetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-amino-2-cyclohexyl-2-phenylacetic acid |
|---|
| CAS Number | 57496-24-9 | Molecular Weight | 233.30600 |
|---|
| Density | 1.164g/cm3 | Boiling Point | 387ºC at 760mmHg |
|---|
| Molecular Formula | C14H19NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 187.9ºC |
|---|
Names
| Name | 2-amino-2-cyclohexyl-2-phenylacetic acid |
|---|
Chemical & Physical Properties
| Density | 1.164g/cm3 |
|---|
| Boiling Point | 387ºC at 760mmHg |
|---|
| Molecular Formula | C14H19NO2 |
|---|
| Molecular Weight | 233.30600 |
|---|
| Flash Point | 187.9ºC |
|---|
| Exact Mass | 233.14200 |
|---|
| PSA | 63.32000 |
|---|
| LogP | 3.20580 |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | BRBQDZBKZKUUMW-UHFFFAOYSA-N |
|---|
| SMILES | NC(C(=O)O)(c1ccccc1)C1CCCCC1 |
|---|