Introduction:Basic information about CAS 120889-05-6|2-chloro-1-methyl-6-phenylimidazo[4,5-b]pyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-chloro-1-methyl-6-phenylimidazo[4,5-b]pyridine |
|---|
| CAS Number | 120889-05-6 | Molecular Weight | 243.69200 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 442.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H10ClN3 | Melting Point | 179-182ºC |
|---|
| MSDS | / | Flash Point | 221.5ºC |
|---|
Names
| Name | 2-chloro-1-methyl-6-phenylimidazo[4,5-b]pyridine |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 442.7ºC at 760 mmHg |
|---|
| Melting Point | 179-182ºC |
|---|
| Molecular Formula | C13H10ClN3 |
|---|
| Molecular Weight | 243.69200 |
|---|
| Flash Point | 221.5ºC |
|---|
| Exact Mass | 243.05600 |
|---|
| PSA | 30.71000 |
|---|
| LogP | 3.28870 |
|---|
| Vapour Pressure | 4.92E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.672 |
|---|
| InChIKey | FBFVKWMIRFROSV-UHFFFAOYSA-N |
|---|
| SMILES | Cn1c(Cl)nc2ncc(-c3ccccc3)cc21 |
|---|