Introduction：Basic information about CAS 5366-49-4|2-Propanone, 1-(p-tolylsulfonyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Propanone, 1-(p-tolylsulfonyl)- |
|---|
| CAS Number | 5366-49-4 | Molecular Weight | 212.266 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 379.4±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H12O3S | Melting Point | 52 °C |
|---|
| MSDS | / | Flash Point | 229.0±20.6 °C |
|---|
Names
| Name | 1-(4-methylphenyl)sulfonylpropan-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 379.4±42.0 °C at 760 mmHg |
|---|
| Melting Point | 52 °C |
|---|
| Molecular Formula | C10H12O3S |
|---|
| Molecular Weight | 212.266 |
|---|
| Flash Point | 229.0±20.6 °C |
|---|
| Exact Mass | 212.050720 |
|---|
| PSA | 59.59000 |
|---|
| LogP | 0.27 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.522 |
|---|
| InChIKey | NDQXJNHOGLQSMB-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)CS(=O)(=O)c1ccc(C)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2914399090 |
|---|
Customs
| HS Code | 2914399090 |
|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| p-toluenesulfonylpropan-2-one |
| 1-(p-tolylsulfonyl)-2-propanone |
| 4-toluenesulfonylacetoacetate |
| MFCD00026240 |
| EINECS 226-353-2 |
| 1-[(4-methylphenyl)sulfonyl]propan-2-one |
| 2-Propanone, 1-(p-tolylsulfonyl)- |
| 1-[(4-Methylphenyl)sulfonyl]acetone |
| 2-Propanone, 1-[(4-methylphenyl)sulfonyl]- |
| 4-Toluenesulfonylacetone |
