Introduction：Basic information about CAS 95105-77-4|Sornidipine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sornidipine |
|---|
| CAS Number | 95105-77-4 | Molecular Weight | 460.43400 |
|---|
| Density | 1.44g/cm3 | Boiling Point | 641ºC at 760mmHg |
|---|
| Molecular Formula | C22H24N2O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 341.5ºC |
|---|
Names
| Name | 5-O-[(3S,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 3-O-methyl 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.44g/cm3 |
|---|
| Boiling Point | 641ºC at 760mmHg |
|---|
| Molecular Formula | C22H24N2O9 |
|---|
| Molecular Weight | 460.43400 |
|---|
| Flash Point | 341.5ºC |
|---|
| Exact Mass | 460.14800 |
|---|
| PSA | 149.14000 |
|---|
| LogP | 1.92490 |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | ODVDIRMTZXLSKT-OBNKQFAMSA-N |
|---|
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC2COC3C(O)COC23)C1c1ccccc1[N+](=O)[O-] |
|---|
Synonyms
| UNII-Z82YP691V7 |
| Sornidipine |
