Introduction：Basic information about CAS 15847-18-4|7-Aminoflavone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Aminoflavone |
|---|
| CAS Number | 15847-18-4 | Molecular Weight | 237.25300 |
|---|
| Density | 1.306g/cm3 | Boiling Point | 451.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H11NO2 | Melting Point | 184-188ºC(lit.) |
|---|
| MSDS | / | Flash Point | 239.8ºC |
|---|
Names
| Name | 7-amino-2-phenylchromen-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.306g/cm3 |
|---|
| Boiling Point | 451.6ºC at 760 mmHg |
|---|
| Melting Point | 184-188ºC(lit.) |
|---|
| Molecular Formula | C15H11NO2 |
|---|
| Molecular Weight | 237.25300 |
|---|
| Flash Point | 239.8ºC |
|---|
| Exact Mass | 237.07900 |
|---|
| PSA | 56.23000 |
|---|
| LogP | 3.62340 |
|---|
| Vapour Pressure | 2.4E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.677 |
|---|
| InChIKey | JGSKYGCPGCBEET-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc2c(=O)cc(-c3ccccc3)oc2c1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| HS Code | 2922399090 |
|---|
Customs
| HS Code | 2922399090 |
|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 7-Amino-2-phenyl-chromen-4-on |
| I05-3306 |
| 7-Aminoflavon |
| 7-amino-2-phenyl-chromen-4-one |
| MFCD05664255 |
| 7-Aminoflavone |
| 4H-1-Benzopyran-4-one,7-amino-2-phenyl |
| 7-amino-2-phenyl-4H-chromen-4-one |
