Introduction：Basic information about CAS 51652-35-8|5-methoxy-2,4-dinitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-methoxy-2,4-dinitrophenol |
|---|
| CAS Number | 51652-35-8 | Molecular Weight | 214.13200 |
|---|
| Density | 1.579g/cm3 | Boiling Point | 397.5ºC at 760mmHg |
|---|
| Molecular Formula | C7H6N2O6 | Melting Point | 107-109ºC |
|---|
| MSDS | / | Flash Point | 194.2ºC |
|---|
Names
| Name | 5-methoxy-2,4-dinitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.579g/cm3 |
|---|
| Boiling Point | 397.5ºC at 760mmHg |
|---|
| Melting Point | 107-109ºC |
|---|
| Molecular Formula | C7H6N2O6 |
|---|
| Molecular Weight | 214.13200 |
|---|
| Flash Point | 194.2ºC |
|---|
| Exact Mass | 214.02300 |
|---|
| PSA | 121.10000 |
|---|
| LogP | 2.26360 |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | IASWEPJOUWXONE-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(O)c([N+](=O)[O-])cc1[N+](=O)[O-] |
|---|
Safety Information
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2909500000 |
|---|
Customs
| HS Code | 2909500000 |
|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4.6-Dinitro-3-hydroxy-1-methoxy-benzol |
| 4.6-dinitro-3-hydroxy-1-methoxy-benzene |
| Phenol,5-methoxy-2,4-dinitro |
| 5-methoxy-2,4-dinitro-phenol |
| 2,4-Dinitro-5-methoxyphenol |
| 4.6-Dinitro-resorcinmonomethylaether |
| 4,6-dinitro-3-methoxyphenol |
