Introduction：Basic information about CAS 19008-62-9|2-(3-nitrophenyl)ethanamine hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(3-nitrophenyl)ethanamine hydrochloride |
|---|
| CAS Number | 19008-62-9 | Molecular Weight | 202.638 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H11ClN2O2 | Melting Point | 211-215ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3-Nitro-phenEthylaminehydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 211-215ºC |
|---|
| Molecular Formula | C8H11ClN2O2 |
|---|
| Molecular Weight | 202.638 |
|---|
| Exact Mass | 202.050903 |
|---|
| PSA | 71.84000 |
|---|
| LogP | 3.12150 |
|---|
| InChIKey | IZWJXFFJQRETII-UHFFFAOYSA-N |
|---|
| SMILES | Cl.NCCc1cccc([N+](=O)[O-])c1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn |
|---|
| Risk Phrases | R22 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2921499090 |
|---|
Customs
| HS Code | 2921499090 |
|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-Nitro-phenaethylamin,Hydrochlorid |
| Benzeneethanamine, 3-nitro-, hydrochloride (1:1) |
| 3-nitrophenethylamine hydrochloride |
| M-nitrophenylethylaMine hydrochloride |
| 2-(3-Nitrophenyl)ethanamine hydrochloride (1:1) |
| 3-Nitrophenethylamine hydrochloride,3-Nitrobenzeneethanamine hydrochloride |
| 2-(3-nitrophenyl)ethanamine hydrochloride |
