Introduction：Basic information about CAS 193975-33-6|5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4(3H)-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4(3H)-one |
|---|
| CAS Number | 193975-33-6 | Molecular Weight | 361.56300 |
|---|
| Density | 1.519g/cm3 | Boiling Point | 398.997ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9ClINO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 195.107ºC |
|---|
Names
| Name | ethyl 4-chloro-8-iodoquinoline-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.519g/cm3 |
|---|
| Boiling Point | 398.997ºC at 760 mmHg |
|---|
| Molecular Formula | C12H9ClINO2 |
|---|
| Molecular Weight | 361.56300 |
|---|
| Flash Point | 195.107ºC |
|---|
| Exact Mass | 360.93700 |
|---|
| PSA | 39.19000 |
|---|
| LogP | 3.66950 |
|---|
| Index of Refraction | 1.73 |
|---|
| InChIKey | JVNZFPUXWUBKAW-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cnc2c(I)cccc2c1Cl |
|---|
Synonyms
| A4268 |
| ethyl 8-iodo-4-chloro-3-quinolinecarboxylate |
| 3-Quinolinecarboxylic acid,4-chloro-8-iodo-,ethyl ester |
