Introduction：Basic information about CAS 194473-03-5|7-fluoro-2-methylquinazolin-4-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-fluoro-2-methylquinazolin-4-ol |
|---|
| CAS Number | 194473-03-5 | Molecular Weight | 178.163 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 169.3±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7FN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 56.2±25.4 °C |
|---|
Names
| Name | 7-fluoro-2-methyl-1H-quinazolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 169.3±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H7FN2O |
|---|
| Molecular Weight | 178.163 |
|---|
| Flash Point | 56.2±25.4 °C |
|---|
| Exact Mass | 178.054245 |
|---|
| PSA | 45.75000 |
|---|
| LogP | 0.56 |
|---|
| Vapour Pressure | 1.2±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.649 |
|---|
| InChIKey | BLFIAQNYLCTAMP-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc2cc(F)ccc2c(=O)[nH]1 |
|---|
Synonyms
| 4-quinazolinol, 7-fluoro-2-methyl- |
| 7-fluoro-2-methylquinazolin-4-ol |
| 7-fluoro-2-methyl-3H-quinazolin-4-one |
| 7-Fluoro-2-methyl-4-quinazolinol |
