Introduction：Basic information about CAS 201940-08-1|tert-Butyl 5-bromoisoindoline-2-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl 5-bromoisoindoline-2-carboxylate |
|---|
| CAS Number | 201940-08-1 | Molecular Weight | 298.176 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 354.7±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16BrNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 168.3±27.9 °C |
|---|
Names
| Name | tert-butyl 5-bromo-1,3-dihydroisoindole-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 354.7±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16BrNO2 |
|---|
| Molecular Weight | 298.176 |
|---|
| Flash Point | 168.3±27.9 °C |
|---|
| Exact Mass | 297.036438 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 3.22 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.570 |
|---|
| InChIKey | GOKHEUCWNVPUSC-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1Cc2ccc(Br)cc2C1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Synonyms
| 2-Methyl-2-propanyl 5-bromo-1,3-dihydro-2H-isoindole-2-carboxylate |
| 5-bromo-1,3-dihydro-isoindoline-2-carboxylic acid tert-butyl ester |
| tert-butyl 5-bromo-iso-indoline-2-carboxylate |
| N-BOC-5-BROMOISOINDOLINE |
| 5-bromo-1,3-dihydro-isoindole-2-carboxylic acid tert-butyl ester |
| tert-Butyl 5-bromo-1,3-dihydro-2H-isoindole-2-carboxylate |
| 2-Boc-5-bromoisoindoline |
| SC3981 |
| 1,1-dimethylethyl 5-bromo-1,3-dihydro-2H-isoindole-2-carboxylate |
| 2H-Isoindole-2-carboxylic acid, 5-bromo-1,3-dihydro-, 1,1-dimethylethyl ester |
| tert-butyl 5-bromo-1,3-dihydro-isoindole-2-carboxylate |
| tert-butyl 5-bromo-2,3-dihydro-1H-isoindole-2-ncarboxylate |
| tert-Butyl 5-bromoisoindoline-2-carboxylate |
