Introduction：Basic information about CAS 20201-03-0|2-Chloro-4-nitrobenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-4-nitrobenzenesulfonyl chloride |
|---|
| CAS Number | 20201-03-0 | Molecular Weight | 256.063 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 370.3±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3Cl2NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 177.7±25.1 °C |
|---|
Names
| Name | 2-chloro-4-nitrobenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 370.3±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3Cl2NO4S |
|---|
| Molecular Weight | 256.063 |
|---|
| Flash Point | 177.7±25.1 °C |
|---|
| Exact Mass | 254.915985 |
|---|
| PSA | 88.34000 |
|---|
| LogP | 2.64 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.600 |
|---|
| InChIKey | QWNVNPSFHISUID-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Cl)c(Cl)c1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | T+ |
|---|
| RIDADR | 2928.0 |
|---|
| Hazard Class | 6.1，8 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2-Chloro-4-nitrophenylsulfonyl chloride |
| 2-Chloro-4-nitrobenzenesulfonyl chloride |
| Benzenesulfonyl chloride, 2-chloro-4-nitro- |
| 2-Chlorsulfonyl-5-nitro-chlorbenzol |
| 2-Chloro-4-nitrophenylsulphonyl chloride |
| WSGR BG DNW |
| 2-Chlor-4-nitrobenzolsulfonylchlorid |
| 2-Chloro-4-nitrobenzene-1-sulfonyl chloride |
| 2-Chlor-4-nitro-benzolsulfochlorid |
| 2-Chloro-4-nitro-benzenesulfonyl chloride |
| 2-Chlor-4-nitro-benzolsulfonsaeurechlorid |
