Introduction：Basic information about CAS 118353-05-2|Carbovir, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Carbovir |
|---|
| CAS Number | 118353-05-2 | Molecular Weight | 247.25300 |
|---|
| Density | 1.76g/cm3 | Boiling Point | 605.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13N5O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 320.1ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.76g/cm3 |
|---|
| Boiling Point | 605.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13N5O2 |
|---|
| Molecular Weight | 247.25300 |
|---|
| Flash Point | 320.1ºC |
|---|
| Exact Mass | 247.10700 |
|---|
| PSA | 109.82000 |
|---|
| LogP | 0.39250 |
|---|
| Vapour Pressure | 1.62E-15mmHg at 25°C |
|---|
| Index of Refraction | 1.841 |
|---|
| InChIKey | XSSYCIGJYCVRRK-NKWVEPMBSA-N |
|---|
| SMILES | Nc1nc2c(ncn2C2C=CC(CO)C2)c(=O)[nH]1 |
|---|
