Introduction:Basic information about CAS 868071-17-4|(3S)-2',4',5'-trifluoro-3-hydroxybenzenebutanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3S)-2',4',5'-trifluoro-3-hydroxybenzenebutanoic acid |
|---|
| CAS Number | 868071-17-4 | Molecular Weight | 234.17200 |
|---|
| Density | 1.459 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H9F3O3 | Melting Point | 87ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (3S)-3-hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.459 g/cm3 |
|---|
| Melting Point | 87ºC |
|---|
| Molecular Formula | C10H9F3O3 |
|---|
| Molecular Weight | 234.17200 |
|---|
| Exact Mass | 234.05000 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 1.48200 |
|---|
| InChIKey | WHFKHBXZZAXQOD-LURJTMIESA-N |
|---|
| SMILES | O=C(O)CC(O)Cc1cc(F)c(F)cc1F |
|---|
Safety Information
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| (S)-3-Hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid |
| (S)-3-hydroxy-4-(2,4,5-trifluorophenyl)butyric acid |
| 4-(2,4,5-trifluorophenyl)-3(S)-hydroxybutanoic acid |
| (3S)-2',4',5'-Trifluoro-3-hydroxybenzenebutanoic acid |
| 3(S)-4-(2,4,5-trifluorophenyl)-3-hydroxybutanoic acid |
| (3S)-3-hydroxy-4-(2,4,5-trifluorophenyl)-butyric acid |
| 3(S)-4-(2,4,5-trifluorophenyl)-3-hydroxybenzenebutanoic acid |