Introduction：Basic information about CAS 26567-23-7|2-Chloro-6-(diethylamino)-fluoran, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-6-(diethylamino)-fluoran |
|---|
| CAS Number | 26567-23-7 | Molecular Weight | 405.87400 |
|---|
| Density | 1.37g/cm3 | Boiling Point | 596.6ºC at 760mmHg |
|---|
| Molecular Formula | C24H20ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 314.6ºC |
|---|
Names
| Name | 2'-Chloro-6'-diethylaminofluoran |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37g/cm3 |
|---|
| Boiling Point | 596.6ºC at 760mmHg |
|---|
| Molecular Formula | C24H20ClNO3 |
|---|
| Molecular Weight | 405.87400 |
|---|
| Flash Point | 314.6ºC |
|---|
| Exact Mass | 405.11300 |
|---|
| PSA | 38.77000 |
|---|
| LogP | 5.75420 |
|---|
| Vapour Pressure | 3.37E-14mmHg at 25°C |
|---|
| Index of Refraction | 1.685 |
|---|
| InChIKey | GSCLSACFHWKTQU-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)c1ccc2c(c1)Oc1ccc(Cl)cc1C21OC(=O)c2ccccc21 |
|---|
Synonyms
| 2'-Chloro-6'-diethylaminospiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one |
| 2-Chloro-6-(diethylamino)-fluoran |
| 2'-Chloro-6'-diethylaminospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one |
| Spiro(isobenzofuran-1(3H),9'-(9H)xanthen)-3-one,2'-chloro-6'-(diethylaMino)//PSD-HR |
