Introduction:Basic information about CAS 123246-29-7|Ganirelix, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ganirelix |
|---|
| CAS Number | 123246-29-7 | Molecular Weight | 1570.319 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C80H113ClN18O13 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | ganirelix |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Molecular Formula | C80H113ClN18O13 |
|---|
| Molecular Weight | 1570.319 |
|---|
| Exact Mass | 1568.842285 |
|---|
| PSA | 451.49000 |
|---|
| LogP | 6.75 |
|---|
| Index of Refraction | 1.632 |
|---|
| InChIKey | BNXQPWOTZJCGRG-FEGBTNLQSA-N |
|---|
| SMILES | CC(=O)O.CCNC(=NCCCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)NC(=O)C(Cc1cccnc1)NC(=O)C(Cc1ccc(Cl)cc1)NC(=O)C(Cc1ccc2ccccc2c1)NC(C)=O)C(=O)NC(CC(C)C)C(=O)NC(CCCCN=C(NCC)NCC)C(=O)N1CCCC1C(=O)NC(C)C(N)=O)NCC |
|---|
Synonyms
| N-Acetyl-3-(2-naphthyl)-D-alanyl-4-chloro-D-phenylalanyl-3-(3-pyridinyl)-D-alanyl-L-seryl-L-tyrosyl-N-[bis(ethylamino)methylene]-D-lysyl-L-leucyl-N-[bis(ethylamino)methylene]-L-lysyl-L-prolyl-D- ;alaninamide |
| Ganirelix |
| D-Alaninamide, N-acetyl-3-(2-naphthalenyl)-D-alanyl-4-chloro-D-phenylalanyl-3-(3-pyridinyl)-D-alanyl-L-seryl-L-tyrosyl-N-[bis(ethylamino)methylene]-D-lysyl-L-leucyl-N-[bis(ethylamino)methylene]- ;L-lysyl-L-prolyl- |
| Ganirelix acetate |