Introduction：Basic information about CAS 51987-65-6|Desglugastrin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Desglugastrin |
|---|
| CAS Number | 51987-65-6 | Molecular Weight | 984.06100 |
|---|
| Density | 1.339g/cm3 | Boiling Point | 1497ºC at 760mmHg |
|---|
| Molecular Formula | C49H61N9O13 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 859.2ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.339g/cm3 |
|---|
| Boiling Point | 1497ºC at 760mmHg |
|---|
| Molecular Formula | C49H61N9O13 |
|---|
| Molecular Weight | 984.06100 |
|---|
| Flash Point | 859.2ºC |
|---|
| Exact Mass | 983.43900 |
|---|
| PSA | 357.41000 |
|---|
| LogP | 3.64390 |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | BRUVESZIOCJLDB-GJPUTSFASA-N |
|---|
| SMILES | CC(C)CC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)C(Cc1ccc(O)cc1)NC(=O)C(C)NC(=O)CCCC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(Cc1ccccc1)C(N)=O |
|---|
