Introduction：Basic information about CAS 99287-30-6|egualen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | egualen |
|---|
| CAS Number | 99287-30-6 | Molecular Weight | 278.36700 |
|---|
| Density | 1.214g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C15H18O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | egualen |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.214g/cm3 |
|---|
| Molecular Formula | C15H18O3S |
|---|
| Molecular Weight | 278.36700 |
|---|
| Exact Mass | 278.09800 |
|---|
| PSA | 62.75000 |
|---|
| LogP | 4.80470 |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | NARQSHREEUXZBT-UHFFFAOYSA-N |
|---|
| SMILES | CCc1cc(S(=O)(=O)O)c2cc(C(C)C)cccc1-2 |
|---|
Synonyms
| Egualene [INN-French] |
| Egualeno |
| Egualenum [INN-Latin] |
| Egualeno [INN-Spanish] |
| Azuletil |
| Egualen |
| Egualene |
| 3-ethyl-7-propan-2-ylazulene-1-sulfonic acid |
| Egualenum |
| UNII-17VM9WN49U |
