Introduction:Basic information about CAS 124784-31-2|Erbulozole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Erbulozole |
|---|
| CAS Number | 124784-31-2 | Molecular Weight | 469.55300 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 632.9ºC at 760mmHg |
|---|
| Molecular Formula | C24H27N3O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 336.5ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 632.9ºC at 760mmHg |
|---|
| Molecular Formula | C24H27N3O5S |
|---|
| Molecular Weight | 469.55300 |
|---|
| Flash Point | 336.5ºC |
|---|
| Exact Mass | 469.16700 |
|---|
| PSA | 109.14000 |
|---|
| LogP | 4.59380 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | KLEPCGBEXOCIGS-ZJSXRUAMSA-N |
|---|
| SMILES | CCOC(=O)Nc1ccc(SCC2COC(Cn3ccnc3)(c3ccc(OC)cc3)O2)cc1 |
|---|