Introduction：Basic information about CAS 54661-82-4|Furbenicillin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Furbenicillin |
|---|
| CAS Number | 54661-82-4 | Molecular Weight | 486.49800 |
|---|
| Density | 1.53g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C22H22N4O7S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Furbenicillin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.53g/cm3 |
|---|
| Molecular Formula | C22H22N4O7S |
|---|
| Molecular Weight | 486.49800 |
|---|
| Exact Mass | 486.12100 |
|---|
| PSA | 183.35000 |
|---|
| LogP | 2.20260 |
|---|
| Index of Refraction | 1.681 |
|---|
| InChIKey | AWBJVSUGLZFBOG-BWMCOSIFSA-N |
|---|
| SMILES | CC1(C)SC2C(NC(=O)C(NC(=O)NC(=O)c3ccco3)c3ccccc3)C(=O)N2C1C(=O)O |
|---|
Synonyms
| Diisobutylstannium oxide |
| Kyslicnik diisobutylcinicity |
| Diisobutylzinnoxid |
| {(iso-C4H9)2SnO}n |
| di-i-butyltin oxide |
| bis(2-methylpropyl)(oxo)stannane |
| Stannane,diisobutyloxo |
| Kyslicnik diisobutylcinicity [Czech] |
| diisobutyltinoxide |
| Diisobutylzinnoxyd |
| {(R)-[3-(furan-2-carbonyl)-ureido]-phenyl-methyl}-penicillin |
