Introduction:Basic information about CAS 3811-53-8|Propinetidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Propinetidine |
|---|
| CAS Number | 3811-53-8 | Molecular Weight | 299.40700 |
|---|
| Density | 1.07 g/cm3 | Boiling Point | 386.5ºC at 760mmHg |
|---|
| Molecular Formula | C19H25NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 119.6ºC |
|---|
Names
| Name | [1-(2-phenylethyl)-4-prop-2-ynylpiperidin-4-yl] propanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.07 g/cm3 |
|---|
| Boiling Point | 386.5ºC at 760mmHg |
|---|
| Molecular Formula | C19H25NO2 |
|---|
| Molecular Weight | 299.40700 |
|---|
| Flash Point | 119.6ºC |
|---|
| Exact Mass | 299.18900 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 2.97810 |
|---|
| Index of Refraction | 1.546 |
|---|
| InChIKey | BPWLAJREXKWKSB-UHFFFAOYSA-N |
|---|
| SMILES | C#CCC1(OC(=O)CC)CCN(CCc2ccccc2)CC1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-(2-phenylethyl)-4-(prop-2-yn-1-yl)piperidin-4-yl propanoate |
| N-Phenethyl-4-(2-propynyl)-4-propionoxy-piperidin |
| Propinetidine |
| 4-Propionyloxy-4-propargyl-1-phenethyl-piperidin |
| UNII-70QV580PA4 |
| 4-Propionyloxy-4-propargyl-1-phenaethyl-piperidin |
| Propinetidine [INN] |
| 1-phenethyl-4-propionyloxy-4-prop-2-ynyl-piperidine |
| (1-phenethyl-4-prop-2-ynylpiperidin-4-yl) propanoate |