Introduction：Basic information about CAS 143224-34-4|Telinavir, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Telinavir |
|---|
| CAS Number | 143224-34-4 | Molecular Weight | 604.74000 |
|---|
| Density | 1.207g/cm3 | Boiling Point | 974.9ºC at 760mmHg |
|---|
| Molecular Formula | C33H44N6O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 543.4ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.207g/cm3 |
|---|
| Boiling Point | 974.9ºC at 760mmHg |
|---|
| Molecular Formula | C33H44N6O5 |
|---|
| Molecular Weight | 604.74000 |
|---|
| Flash Point | 543.4ºC |
|---|
| Exact Mass | 604.33700 |
|---|
| PSA | 166.75000 |
|---|
| LogP | 4.63610 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | ZILOOGIOHVCEKS-HZFUHODCSA-N |
|---|
| SMILES | CC(C)CN(CC(O)C(Cc1ccccc1)NC(=O)C(CC(N)=O)NC(=O)c1ccc2ccccc2n1)C(=O)NC(C)(C)C |
|---|
