Introduction：Basic information about CAS 42239-60-1|7-chloro-4-(4-methylpiperazin-1-yl)-10H-thieno[3,2-c][1]benzazepine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-chloro-4-(4-methylpiperazin-1-yl)-10H-thieno[3,2-c][1]benzazepine |
|---|
| CAS Number | 42239-60-1 | Molecular Weight | 331.86300 |
|---|
| Density | 1.37g/cm3 | Boiling Point | 473.1ºC at 760 mmHg |
|---|
| Molecular Formula | C17H18ClN3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 239.9ºC |
|---|
Names
| Name | 7-chloro-4-(4-methylpiperazin-1-yl)-10H-thieno[3,2-c][1]benzazepine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37g/cm3 |
|---|
| Boiling Point | 473.1ºC at 760 mmHg |
|---|
| Molecular Formula | C17H18ClN3S |
|---|
| Molecular Weight | 331.86300 |
|---|
| Flash Point | 239.9ºC |
|---|
| Exact Mass | 331.09100 |
|---|
| PSA | 47.08000 |
|---|
| LogP | 2.94280 |
|---|
| Index of Refraction | 1.705 |
|---|
| InChIKey | SKASXEDXLXEXKN-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCN(C2=Nc3cc(Cl)ccc3Cc3sccc32)CC1 |
|---|
Synonyms
| UNII-3RG8Q831DX |
| Tilozepina |
| NT 104-252 |
| Tilozepine [INN] |
| Tilozepine |
