Introduction：Basic information about CAS 3569-77-5|Amidapsone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Amidapsone |
|---|
| CAS Number | 3569-77-5 | Molecular Weight | 291.32600 |
|---|
| Density | 1.454g/cm3 | Boiling Point | 536.4ºC at 760mmHg |
|---|
| Molecular Formula | C13H13N3O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 278.2ºC |
|---|
Names
| Name | [4-(4-aminophenyl)sulfonylphenyl]urea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.454g/cm3 |
|---|
| Boiling Point | 536.4ºC at 760mmHg |
|---|
| Molecular Formula | C13H13N3O3S |
|---|
| Molecular Weight | 291.32600 |
|---|
| Flash Point | 278.2ºC |
|---|
| Exact Mass | 291.06800 |
|---|
| PSA | 123.66000 |
|---|
| LogP | 4.02750 |
|---|
| Index of Refraction | 1.682 |
|---|
| InChIKey | UPWPBIUUSLIWAI-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| p-Amino-p'-ureidodiphenyl sulfone |
| Sulfone,p-aminophenyl p-ureidophenyl |
| 4-Amino-4'-ureidodiphenyl sulfone |
| [4-(4-Amino-phenylsulfon)-phenyl]-harnstoff |
| 4-(N-Sulfanilyl)phenylurea |
| Sulfacid |
| (4-Sulfanilylphenyl)urea |
| Sulfacide |
| 4-Sulfanilylphenylharnstoff |
| Amidapsone |
