Introduction:Basic information about CAS 75458-65-0|Tienocarbine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tienocarbine |
|---|
| CAS Number | 75458-65-0 | Molecular Weight | 256.36600 |
|---|
| Density | 1.284g/cm3 | Boiling Point | 441.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16N2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.7ºC |
|---|
Names
| Name | Tienocarbine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.284g/cm3 |
|---|
| Boiling Point | 441.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H16N2S |
|---|
| Molecular Weight | 256.36600 |
|---|
| Flash Point | 220.7ºC |
|---|
| Exact Mass | 256.10300 |
|---|
| PSA | 47.27000 |
|---|
| LogP | 3.61680 |
|---|
| Index of Refraction | 1.734 |
|---|
| InChIKey | GMIILPOVBUNJBY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1csc2ccc3[nH]c4c(c3c12)CN(C)CC4 |
|---|
Synonyms
| 1,9-dimethyl-7,8,9,10-tetrahydrothieno[3,2-e]pyrido[4,3-b]indole |
| 1,9-Dimethyl-7,8,9,10-tetrahydro-6H-pyrido[4,3-b]thieno[3,2-e]indole |