Introduction:Basic information about CAS 128326-80-7|Nicoracetam, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nicoracetam |
|---|
| CAS Number | 128326-80-7 | Molecular Weight | 220.22500 |
|---|
| Density | 1.291g/cm3 | Boiling Point | 404.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198.5ºC |
|---|
Names
| Name | 1-(6-methoxypyridine-3-carbonyl)pyrrolidin-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.291g/cm3 |
|---|
| Boiling Point | 404.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12N2O3 |
|---|
| Molecular Weight | 220.22500 |
|---|
| Flash Point | 198.5ºC |
|---|
| Exact Mass | 220.08500 |
|---|
| PSA | 59.50000 |
|---|
| LogP | 0.79070 |
|---|
| Vapour Pressure | 9.3E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | WLMMDVSGDYEVAD-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)N2CCCC2=O)cn1 |
|---|
Synonyms
| 2-Pyrrolidinone,1-((6-methoxy-3-pyridinyl)carbonyl) |
| UNII-8U10GC2V6Y |
| Nicoracetam |
| Nicoracetam [INN] |