Introduction：Basic information about CAS 54063-29-5|Cicarperone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cicarperone |
|---|
| CAS Number | 54063-29-5 | Molecular Weight | 362.43800 |
|---|
| Density | 1.21g/cm3 | Boiling Point | 540.9ºC at 760mmHg |
|---|
| Molecular Formula | C20H27FN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 280.9ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.21g/cm3 |
|---|
| Boiling Point | 540.9ºC at 760mmHg |
|---|
| Molecular Formula | C20H27FN2O3 |
|---|
| Molecular Weight | 362.43800 |
|---|
| Flash Point | 280.9ºC |
|---|
| Exact Mass | 362.20100 |
|---|
| PSA | 72.63000 |
|---|
| LogP | 4.15520 |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | RVPQELWEPXXXPC-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)OC1CCN(CCCC(=O)c2ccc(F)cc2)C2CCCCC12 |
|---|
