Introduction：Basic information about CAS 90055-97-3|Tienoxolol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tienoxolol |
|---|
| CAS Number | 90055-97-3 | Molecular Weight | 420.52200 |
|---|
| Density | 1.229g/cm3 | Boiling Point | 524.4ºC at 760mmHg |
|---|
| Molecular Formula | C21H28N2O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 270.9ºC |
|---|
Names
| Name | ethyl 2-[3-(tert-butylamino)-2-hydroxypropoxy]-5-(thiophene-2-carbonylamino)benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.229g/cm3 |
|---|
| Boiling Point | 524.4ºC at 760mmHg |
|---|
| Molecular Formula | C21H28N2O5S |
|---|
| Molecular Weight | 420.52200 |
|---|
| Flash Point | 270.9ºC |
|---|
| Exact Mass | 420.17200 |
|---|
| PSA | 125.13000 |
|---|
| LogP | 3.76880 |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | PHMRLCQEIQGCHH-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(NC(=O)c2cccs2)ccc1OCC(O)CNC(C)(C)C |
|---|
Synonyms
| Tienoxololum |
| Tienoxolol |
| Tienoxololum [Latin] |
| ethyl 2-<3-<(1,1-dimethylethyl)amino>-2-hydroxypropoxy>-5-<(2-thienylcarbonyl)amino>benzoate |
| (+-)-Ethyl 2-(3-(tert-butylamino)-2-hydroxypropoxy)-5-(2-thiophenecarboxamido)benzoate |
