Introduction：Basic information about CAS 55313-67-2|Pipramadol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pipramadol |
|---|
| CAS Number | 55313-67-2 | Molecular Weight | 406.98900 |
|---|
| Density | 1.16g/cm3 | Boiling Point | 558.6ºC at 760 mmHg |
|---|
| Molecular Formula | C23H35ClN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 291.6ºC |
|---|
Names
| Name | 2-[1-[2-(2-chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N-cyclohexyl-N-methylpropanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.16g/cm3 |
|---|
| Boiling Point | 558.6ºC at 760 mmHg |
|---|
| Molecular Formula | C23H35ClN2O2 |
|---|
| Molecular Weight | 406.98900 |
|---|
| Flash Point | 291.6ºC |
|---|
| Exact Mass | 406.23900 |
|---|
| PSA | 43.78000 |
|---|
| LogP | 4.07450 |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | JRLWHJKUNYBJRC-UHFFFAOYSA-N |
|---|
| SMILES | CC(C(=O)N(C)C1CCCCC1)C1(O)CCN(CCc2ccccc2Cl)CC1 |
|---|
Synonyms
| Pipramadol [INN] |
| UNII-6QR1645G9S |
| 2-(1-o-chlorophenethyl-4-hydroxy-4-piperidyl)-N-cyclohexyl-N-methyl propionic acid amide |
| 2-<1-(2-chlorophenethyl)-4-hydroxy-4-piperidinyl>-N-cyclohexyl-N-methylpropionamide |
| Pipramadol |
