Introduction：Basic information about CAS 26029-10-7|4-(2-methylpropyl)-3-phenyl-1H-1,2,4-triazole-5-thione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2-methylpropyl)-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|
| CAS Number | 26029-10-7 | Molecular Weight | 233.33300 |
|---|
| Density | 1.19g/cm3 | Boiling Point | 313ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15N3S | Melting Point | 187-189ºC |
|---|
| MSDS | / | Flash Point | 143.1ºC |
|---|
Names
| Name | 4-(2-methylpropyl)-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.19g/cm3 |
|---|
| Boiling Point | 313ºC at 760 mmHg |
|---|
| Melting Point | 187-189ºC |
|---|
| Molecular Formula | C12H15N3S |
|---|
| Molecular Weight | 233.33300 |
|---|
| Flash Point | 143.1ºC |
|---|
| Exact Mass | 233.09900 |
|---|
| PSA | 69.51000 |
|---|
| LogP | 2.88980 |
|---|
| Vapour Pressure | 0.000509mmHg at 25°C |
|---|
| Index of Refraction | 1.63 |
|---|
| InChIKey | FPKHPCNVTZTQPN-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)Cn1c(-c2ccccc2)n[nH]c1=S |
|---|
Safety Information
Synonyms
| 4-Isobutyl-5-phenyl-4H-1,2,4-triazole-3-thiol |
| isobutylphenyltriazolylhydrosulfide |
| 4-(2-methylpropyl)-5-phenyl-1,2,4-triazole-3-thiol |
| 4-isobutyl-5-phenyl-2,4-dihydro-[1,2,4]triazole-3-thione |
| 4-Isobutyl-5-phenyl-4H-1,2,4-triazol-3-ylhydrosulfide |
