Introduction：Basic information about CAS 84559-82-0|Z-Ile-Gly-Gly-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Ile-Gly-Gly-OH |
|---|
| CAS Number | 84559-82-0 | Molecular Weight | 379.40800 |
|---|
| Density | 1.236g/cm3 | Boiling Point | 711.4ºC at 760 mmHg |
|---|
| Molecular Formula | C18H25N3O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 384ºC |
|---|
Names
| Name | 2-[[2-[[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]acetyl]amino]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.236g/cm3 |
|---|
| Boiling Point | 711.4ºC at 760 mmHg |
|---|
| Molecular Formula | C18H25N3O6 |
|---|
| Molecular Weight | 379.40800 |
|---|
| Flash Point | 384ºC |
|---|
| Exact Mass | 379.17400 |
|---|
| PSA | 133.83000 |
|---|
| LogP | 1.81720 |
|---|
| Index of Refraction | 1.539 |
|---|
| InChIKey | MVTRAKCVUOLTBC-LRDDRELGSA-N |
|---|
| SMILES | CCC(C)C(NC(=O)OCc1ccccc1)C(=O)NCC(=O)NCC(=O)O |
|---|
Synonyms
| einecs 283-170-0 |
| Z-Ile-Gly-Gly-OH |
