Introduction：Basic information about CAS 1137-96-8|Benzenamine,N-(phenylmethylene)-, N-oxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenamine,N-(phenylmethylene)-, N-oxide |
|---|
| CAS Number | 1137-96-8 | Molecular Weight | 197.23300 |
|---|
| Density | 1.141g/cm3 | Boiling Point | 352.9ºC at 760mmHg |
|---|
| Molecular Formula | C13H11NO | Melting Point | 113-114ºC |
|---|
| MSDS | / | Flash Point | 167.6ºC |
|---|
Names
| Name | N,α-Diphenyl nitrone, |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.141g/cm3 |
|---|
| Boiling Point | 352.9ºC at 760mmHg |
|---|
| Melting Point | 113-114ºC |
|---|
| Molecular Formula | C13H11NO |
|---|
| Molecular Weight | 197.23300 |
|---|
| Flash Point | 167.6ºC |
|---|
| Exact Mass | 197.08400 |
|---|
| PSA | 28.75000 |
|---|
| LogP | 3.47070 |
|---|
| Vapour Pressure | 7.55E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.655 |
|---|
| InChIKey | ZEAUJQWDPKRESH-KAMYIIQDSA-N |
|---|
| SMILES | [O-][N+](=Cc1ccccc1)c1ccccc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Synonyms
| Benzaldehydephenylnitrone |
| N-benzylidenebenzeneamine oxide |
| N-phenyl-C-phenyl nitrone |
| Diphenylnitrone |
| N-phenylbenzylideneamine N-oxide |
| MFCD00013895 |
| EINECS 214-509-2 |
| N-benzylidenephenylamine N-oxide |
| N-(benzylidene)aniline N-oxide |
| N-phenyl-N-phenylmethylidenamine oxide |
| C,N-Diphenylnitrone |
