Introduction：Basic information about CAS 73606-13-0|1,1,2,2-tetrafluoro-2-prop-2-enoxyethanesulfonyl fluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1,2,2-tetrafluoro-2-prop-2-enoxyethanesulfonyl fluoride |
|---|
| CAS Number | 73606-13-0 | Molecular Weight | 240.14800 |
|---|
| Density | 1.492g/cm3 | Boiling Point | 112ºC |
|---|
| Molecular Formula | C5H5F5O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 43.7ºC |
|---|
Names
| Name | 1,1,2,2-tetrafluoro-2-prop-2-enoxyethanesulfonyl fluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.492g/cm3 |
|---|
| Boiling Point | 112ºC |
|---|
| Molecular Formula | C5H5F5O3S |
|---|
| Molecular Weight | 240.14800 |
|---|
| Flash Point | 43.7ºC |
|---|
| Exact Mass | 239.98800 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 2.75470 |
|---|
| Index of Refraction | 1.367 |
|---|
| InChIKey | IMNCTHAFGYFIOE-UHFFFAOYSA-N |
|---|
| SMILES | C=CCOC(F)(F)C(F)(F)S(=O)(=O)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3265 |
|---|
Synonyms
| 2-allyloxy-1,1,2,2-tetrafluoroethanesulfonylfluoride |
| pc9756 |
