Introduction：Basic information about CAS 85418-73-1|ethyl 6-ethyl-4-oxo-1H-quinoline-3-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 6-ethyl-4-oxo-1H-quinoline-3-carboxylate |
|---|
| CAS Number | 85418-73-1 | Molecular Weight | 245.27400 |
|---|
| Density | 1.184g/cm3 | Boiling Point | 378.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 182.8ºC |
|---|
Names
| Name | ethyl 6-ethyl-4-oxo-1H-quinoline-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.184g/cm3 |
|---|
| Boiling Point | 378.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H15NO3 |
|---|
| Molecular Weight | 245.27400 |
|---|
| Flash Point | 182.8ºC |
|---|
| Exact Mass | 245.10500 |
|---|
| PSA | 59.42000 |
|---|
| LogP | 2.67950 |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | ZFOFJXFVCJQXBL-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1c[nH]c2ccc(CC)cc2c1=O |
|---|
Synonyms
| GNF-PF-4421 |
| 3-ethoxycarbonyl-6-ethyl-4(1H)-quinolone |
| ethyl 6-ethyl-4-hydroxyquinoline-3-carboxylate |
| 6-Ethyl-4-hydroxyquinoline-3-carboxylic acid ethyl ester |
