Introduction：Basic information about CAS 196597-77-0|4,5-Dibromo-1,2,6,7-tertahydro-8H-indeno[5,4-b]furan-8-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,5-Dibromo-1,2,6,7-tertahydro-8H-indeno[5,4-b]furan-8-one |
|---|
| CAS Number | 196597-77-0 | Molecular Weight | 331.988 |
|---|
| Density | 2.0±0.1 g/cm3 | Boiling Point | 448.6±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H8Br2O2 | Melting Point | 224-226ºC |
|---|
| MSDS | / | Flash Point | 225.1±28.7 °C |
|---|
Names
| Name | 4,5-dibromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.0±0.1 g/cm3 |
|---|
| Boiling Point | 448.6±45.0 °C at 760 mmHg |
|---|
| Melting Point | 224-226ºC |
|---|
| Molecular Formula | C11H8Br2O2 |
|---|
| Molecular Weight | 331.988 |
|---|
| Flash Point | 225.1±28.7 °C |
|---|
| Exact Mass | 329.889099 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.74 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.677 |
|---|
| InChIKey | KGVRTABDPHWMPF-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CCc2c(Br)c(Br)c3c(c21)CCO3 |
|---|
Synonyms
| 8H-Indeno[5,4-b]furan-8-one, 4,5-dibromo-1,2,6,7-tetrahydro- |
| 4,5-Dibromo-1,2,6,7-tetrahydro-8H-indeno[5,4-b]furan-8-one |
| 4,5-dibromo-1,2,6,7-tetrahydro-8H indeno[5,4-b]furan-8-one |
| 8H-Indeno[5,4-b]furan-8-one,4,5-dibromo-1,2,6,7-tetrahydro |
| 4,5-Dibromo-1,2,6,7-tertahydro-8H-indeno[5,4-b]furan-8-one |
