Introduction：Basic information about CAS 574-81-2|10H-Phenothiazine,3,7-dinitro-, 5-oxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 10H-Phenothiazine,3,7-dinitro-, 5-oxide |
|---|
| CAS Number | 574-81-2 | Molecular Weight | 305.26600 |
|---|
| Density | 1.77g/cm3 | Boiling Point | 589.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H7N3O5S | Melting Point | 260ºC |
|---|
| MSDS | / | Flash Point | 310.4ºC |
|---|
Names
| Name | 3,7-dinitro-10H-phenothiazine 5-oxide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.77g/cm3 |
|---|
| Boiling Point | 589.6ºC at 760mmHg |
|---|
| Melting Point | 260ºC |
|---|
| Molecular Formula | C12H7N3O5S |
|---|
| Molecular Weight | 305.26600 |
|---|
| Flash Point | 310.4ºC |
|---|
| Exact Mass | 305.01100 |
|---|
| PSA | 139.95000 |
|---|
| LogP | 4.77680 |
|---|
| Index of Refraction | 1.806 |
|---|
| InChIKey | VCYRBORHWHUNIK-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc2c(c1)S(=O)c1cc([N+](=O)[O-])ccc1N2 |
|---|
Synonyms
| 3,7-Dinitro-5-oxophenothiazine |
| Dinitrodiphenylamine sulfoxide |
| 3,7-Dinitro-phenothiazin-S-oxid |
| 3,7-Dinitrophenothiazine 5-oxide |
| 3,7-Dinitro-phenothiazin-5-oxid |
