Introduction：Basic information about CAS 67467-96-3|2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propanal, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propanal |
|---|
| CAS Number | 67467-96-3 | Molecular Weight | 218.33500 |
|---|
| Density | 0.924g/cm3 | Boiling Point | 295.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H22O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 130.3ºC |
|---|
Names
| Name | 2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propanal |
|---|
Chemical & Physical Properties
| Density | 0.924g/cm3 |
|---|
| Boiling Point | 295.3ºC at 760 mmHg |
|---|
| Molecular Formula | C15H22O |
|---|
| Molecular Weight | 218.33500 |
|---|
| Flash Point | 130.3ºC |
|---|
| Exact Mass | 218.16700 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.75170 |
|---|
| Index of Refraction | 1.489 |
|---|
| InChIKey | YEDZFQXXPSYBGE-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)(C)c1ccc(CC(C)C=O)cc1 |
|---|
