Introduction:Basic information about CAS 2152-70-7|1,4-Pentadien-3-one, 1,5-bis(5-nitro-2-furanyl)- (9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-Pentadien-3-one, 1,5-bis(5-nitro-2-furanyl)- (9CI) |
|---|
| CAS Number | 2152-70-7 | Molecular Weight | 304.21200 |
|---|
| Density | 1.504g/cm3 | Boiling Point | 494.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H8N2O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 253ºC |
|---|
Names
| Name | (1Z,4E)-1,5-bis(5-nitrofuran-2-yl)penta-1,4-dien-3-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.504g/cm3 |
|---|
| Boiling Point | 494.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H8N2O7 |
|---|
| Molecular Weight | 304.21200 |
|---|
| Flash Point | 253ºC |
|---|
| Exact Mass | 304.03300 |
|---|
| PSA | 134.99000 |
|---|
| LogP | 4.03110 |
|---|
| Vapour Pressure | 6.33E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.667 |
|---|
| InChIKey | LUWVSMYASMXSJY-ZPUQHVIOSA-N |
|---|
| SMILES | O=C(C=Cc1ccc([N+](=O)[O-])o1)C=Cc1ccc([N+](=O)[O-])o1 |
|---|
Safety Information
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 1,4-Pentadien-3-one,1,5-bis(5-nitro-2-furyl) |
| 1,4-Pentadien-3-one,1,5-bis(5-nitro-2-furanyl) |
| 1,5-bis(5-nitro-2-furyl)penta-1,4-dien-3-one |
| 1,5-bis-(5-nitro-furan-2-yl)-penta-1,4-dien-3-one |
| 1,5-Bis(5-nitro-2-furyl)-1,4-pentadien-3-one |
| 1.5-Bis-<5-nitro-2-furyl>-penta-1.4-dien-3-on |
| Bis-<5-nitro-furfuryliden>-aceton |
| 1.5-Bis-<5-nitro-furyl-(2)>-pentadien-(1.4)-on-(3) |