Introduction：Basic information about CAS 80460-02-2|3-Nitrovalerophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Nitrovalerophenone |
|---|
| CAS Number | 80460-02-2 | Molecular Weight | 207.22600 |
|---|
| Density | 1.128g/cm3 | Boiling Point | 343.8ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 159.8ºC |
|---|
Names
| Name | 3-nitro-1-phenylpentan-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.128g/cm3 |
|---|
| Boiling Point | 343.8ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13NO3 |
|---|
| Molecular Weight | 207.22600 |
|---|
| Flash Point | 159.8ºC |
|---|
| Exact Mass | 207.09000 |
|---|
| PSA | 62.89000 |
|---|
| LogP | 2.83790 |
|---|
| Index of Refraction | 1.523 |
|---|
| InChIKey | YLQMBGMZWJYCSW-UHFFFAOYSA-N |
|---|
| SMILES | CCC(CC(=O)c1ccccc1)[N+](=O)[O-] |
|---|
Synonyms
| 4-nitro-1-phenyl-pentan-1-one |
| 3-nitro-1-phenyl-pentan-1-one |
| 3-Nitro-1-phenyl-1-pentanone |
| MFCD07368641 |
| 3-Nitrovalerophenone |
| 1-Pentanone,4-nitro-1-phenyl |
