Introduction：Basic information about CAS 15450-72-3|2(1H)-Quinolinone,8-(acetyloxy)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2(1H)-Quinolinone,8-(acetyloxy)- |
|---|
| CAS Number | 15450-72-3 | Molecular Weight | 203.19400 |
|---|
| Density | 1.272g/cm3 | Boiling Point | 415.1ºC at 760mmHg |
|---|
| Molecular Formula | C11H9NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 204.8ºC |
|---|
Names
| Name | (2-oxo-1H-quinolin-8-yl) acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.272g/cm3 |
|---|
| Boiling Point | 415.1ºC at 760mmHg |
|---|
| Molecular Formula | C11H9NO3 |
|---|
| Molecular Weight | 203.19400 |
|---|
| Flash Point | 204.8ºC |
|---|
| Exact Mass | 203.05800 |
|---|
| PSA | 59.16000 |
|---|
| LogP | 1.45340 |
|---|
| Vapour Pressure | 4.24E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | UTMRKCQYCLEKDL-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1cccc2ccc(=O)[nH]c12 |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-oxo-1,2-dihydroquinolin-8-yl acetate |
| 8-Acetoxy carbostyril |
| 2-hydroxy-8-quinolyl acetate |
| 2-hydroxyquinolin-8-yl acetate |
| F0914-0226 |
| 2,8-quinolinediol,8-acetate |
| 8-acetoxy-1H-quinolin-2-one |
| Acetic acid 2-oxo-1,2-dihydro-quinolin-8-yl ester |
